| Identification | |
| Name: | Indazole-3-carboxylic acid |
| Synonyms: | - |
| CAS: | 4498-67-3 |
| EINECS: | 224-794-5 |
| Molecular Formula: | C8H6N2O2 |
| Molecular Weight: | 162.14544 |
| InChI: | InChI=1S/C8H6N2O2/c11-8(12)7-5-3-1-2-4-6(5)9-10-7/h1-4H,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.506 g/cm3 |
| Refractive index: | 1.743 |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | off-white to yellowish powder |
| Specification: | yellow crystal usageEng:Indole derivatives useful in treatment of pain and inflammation Safety Statements:26-36/37/39-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 22:Do not breathe dust |
| Storage Temperature: | Refrigerator |
| Color: | beige |
| Usage: | Indole derivatives useful in treatment of pain and inflammation |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
