| Identification | |
| Name: | 2-Ethylbenzenethiol |
| Synonyms: | Benzenethiol,o-ethyl- (6CI,7CI,8CI);2-Ethylbenzothiol;o-Ethylbenzenethiol; |
| CAS: | 4500-58-7 |
| EINECS: | 224-811-6 |
| Molecular Formula: | C8H10S |
| Molecular Weight: | 138.23 |
| InChI: | InChI=1/C8H10S/c1-2-7-5-3-4-6-8(7)9/h3-6,9H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.04 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5688-1.5708 |
| Appearance: | clear light yellow liquid |
| Specification: |
2-Ethylbenzenethiol , with CAS number of 4500-58-7, can be called 2-Ethylphenylmercaptan ; Benzenethiol, O-ethyl- ; benzenethiol, 2-ethyl- . It is a clear light yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
