| Identification | |
| Name: | Ethanone, 1,2-diphenyl- |
| Synonyms: | Acetophenone,2-phenyl- (8CI);1,2-Diphenylethan-1-one;1,2-Diphenylethanone;Benzoin, deoxy-;Benzyl phenyl ketone;Deoxybenzoin;Desoxybenzoin;NSC 131456;NSC 249236;NSC 6097;Phenyl benzyl ketone;Phenylmethyl phenyl ketone;a-Phenylacetophenone; |
| CAS: | 451-40-1 |
| EINECS: | 207-193-2 |
| Molecular Formula: | C14H12O |
| Molecular Weight: | 196.25 |
| InChI: | InChI=1/C14H12O/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 319 - 321 C |
| Density: | 1.08 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.583 |
| Water Solubility: | methanol: 0.1 g/mL, clear |
| Solubility: | poor (soluble in hot water) |
| Appearance: | white crystals |
| Specification: | white to off-white crystalline powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| HS Code: | 29143900 |
| Flash Point: | 319 - 321 C |
| Safety Data | |
| Hazard Symbols | |
 |
|
