| Identification | |
| Name: | 2,3-Difluoroaniline |
| Synonyms: | Aniline,2,3-difluoro- (7CI,8CI);2,3-Difluorophenylamine;Benzenamine,2,3-difluoro-; |
| CAS: | 4519-40-8 |
| EINECS: | 224-847-2 |
| Molecular Formula: | C6H5F2N |
| Molecular Weight: | 129.11 |
| InChI: | InChI=1/C6H5F2N/c7-4-2-1-3-5(9)6(4)8/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2941 |
| Density: | 1.274 |
| Stability: | No data. |
| Refractive index: | 1.512-1.514 |
| Appearance: | clear light orange liquid |
| Specification: |
?2,3-Difluoroaniline (CAS NO.4519-40-8), its Synonyms are 2,3-Difluoroaniline, 98% ; 2,3-Difluoroaniline 98% ; 2,3-Difluorophenylamine ; Benzenamine, 2,3-difluoro- . It is clear light orange liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | 2,3-Difluoroaniline (CAS NO.4519-40-8) is used as intermediate for liquid crystal and drugs. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
