Identification |
Name: | Benzeneacetic acid,3-fluoro-4-methoxy- |
Synonyms: | Aceticacid, (3-fluoro-4-methoxyphenyl)- (8CI);(3-Fluoro-4-methoxyphenyl)acetic acid;3-Fluoro-4-methoxybenzeneacetic acid;(3-fluoro-4-methoxyphenyl)acetic acid;3-Fluoro-4-methoxyphenylacetic acid;Benzeneacetic acid, 3-fluoro-4-methoxy-; |
CAS: | 452-14-2 |
EINECS: | 224-854-0 |
Molecular Formula: | C9H9FO3 |
Molecular Weight: | 184.16 |
InChI: | InChI=1/C9H9FO3/c1-13-8-3-2-6(4-7(8)10)5-9(11)12/h2-4H,5H2,1H3,(H,11,12)/p-1 |
Molecular Structure: |
|
Properties |
Melting Point: | 111-113ºC |
Flash Point: | 99.2°C |
Boiling Point: | 240.9°Cat760mmHg |
Density: | 1.456g/cm3 |
Refractive index: | 1.519 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 99.2°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|