| Identification | |
| Name: | 2,5-Difluorotoluene |
| Synonyms: | Toluene,2,5-difluoro- (6CI,7CI,8CI);Benzene, 1,4-difluoro-2-methyl-;NSC 25757; |
| CAS: | 452-67-5 |
| EINECS: | 207-205-6 |
| Molecular Formula: | C7H6F2 |
| Molecular Weight: | 128.12 |
| InChI: | InChI=1/C7H6F2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 2 |
| Melting Point: | -35ºC |
| Density: | 1.36 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.451-1.453 |
| Solubility: | Insoluble |
| Appearance: | colorless to light yellow liquid |
| Specification: | colorless to light yellow liqui Safety Statements:16-29-33 16:Keep away from sources of ignition - No smoking 29:Do not empty into drains 33:Take precautionary measures against static discharges |
| Packinggroup: | II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
