| Identification | |
| Name: | D(+)-Glyceraldehyde |
| Synonyms: | D-(+)-Glyceraldehyde; (R)-(+)-2,3-Dihydroxypropanal |
| CAS: | 453-17-8 |
| EINECS: | 207-217-1 |
| Molecular Formula: | C3H6O3 |
| Molecular Weight: | 90.08 |
| InChI: | InChI=1/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2/t3-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 127-129 C |
| Density: | 1.272g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.494 |
| Solubility: | Very soluble |
| Appearance: | Orange, viscous liquid. |
| Specification: | CLEAR ORANGE SYRUP Safety Statements:26-27-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | I; II; III |
| Usage: | Intermediate in glycolysis, gluconeogenesis and the calvin cycle. |
| Safety Data | |
 |
|
