| Identification |
| Name: | 2-Chloro-5-nitropyridine |
| Synonyms: | Pyridine, 2-chloro-5-nitro-;5-20-05-00452 (Beilstein Handbook Reference);Pyridine(2-Chloro-5-nitropyridine);2-chloro-5-methyl-pyridine; |
| CAS: | 4548-45-2 |
| EINECS: | 224-908-3 |
| Molecular Formula: | C5H3ClN2O2 |
| Molecular Weight: | 158.54 |
| InChI: | InChI=1/C5H3ClN2O2/c6-5-2-1-4(3-7-5)8(9)10/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.489 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.587 |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | Light yellow to beige Powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
