| Identification | |
| Name: | Benzene,1-(dibromomethyl)-3-fluoro- |
| Synonyms: | Toluene, a,a-dibromo-m-fluoro- (7CI,8CI);1-(Dibromomethyl)-3-fluorobenzene; 3-Fluorobenzal bromide |
| CAS: | 455-34-5 |
| Molecular Formula: | C7H5 Br2 F |
| Molecular Weight: | 267.92 |
| InChI: | InChI=1/C7H5Br2F/c8-7(9)5-2-1-3-6(10)4-5/h1-4,7H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 2 |
| Flash Point: | 93°C |
| Boiling Point: | 230.2°Cat760mmHg |
| Density: | 1.954g/cm3 |
| Refractive index: | n20/D 1.587(lit.) |
| Specification: | CLEAR ORANGE LIQUID Safety Statements:26-27-28-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 93°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
