| Identification | ||
| Name: | 3-Fluorobenzoic acid | |
| Synonyms: | Fluorobenzoicacidwhitepowder; m-Fluorobenzoic acid; 2-chloro-4-fluorobenzoic acid; RARECHEM AL BO 0038; 3-fluoro-benzoicaci; 3-Fluorobenzonicacid; Benzoic acid, m-fluoro-; meta-Fluorobenzoic acid; LABOTEST-BB LT01148320 | |
| CAS: | 455-38-9 | |
| EINECS: | 207-248-0 | |
| Molecular Formula: | C7H5FO2 | |
| Molecular Weight: | 140.11 | |
| InChI: | InChI=1/C7H5FO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 25kgs | |
| Density: | 1.319 g/cm3 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Water Solubility: | soluble in hot water AUTOIGNITION | |
| Solubility: | soluble in hot water AUTOIGNITION | |
| Appearance: | white to off-white crystalline powder | |
| Specification: | white to light yellow crystal powder Safety Statements:22-28-24/25-37/39-26-36 22:Do not breathe dust 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing | |
| HS Code: | 29163900 | |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
