| Identification |
| Name: | Benzene,1-(bromomethyl)-3-fluoro- |
| Synonyms: | Toluene,a-bromo-m-fluoro- (6CI,7CI,8CI);(3-Fluorophenyl)methyl bromide;1-(Bromomethyl)-3-fluorobenzene;3-(Bromomethyl)fluorobenzene;NSC 91494;m-Fluorobenzylbromide;a-Bromo-3-fluorotoluene; |
| CAS: | 456-41-7 |
| EINECS: | 207-263-2 |
| Molecular Formula: | C7H6BrF |
| Molecular Weight: | 189.03 |
| InChI: | InChI=1/C7H6BrF/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 1.541 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Reacts with water to form toxic fumes. |
| Refractive index: | 1.545-1.548 |
| Appearance: | Colorless to light yellow liquid |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
