| Identification |
| Name: | Sulfoxylic acid,mono[[[5-[(3-amino-4-hydroxyphenyl)diarsenyl]-2-hydroxyphenyl]amino]methyl]ester, sodium salt (1:1) |
| Synonyms: | Methanol,[5-[(3-amino-4-hydroxyphenyl)arseno]-2-hydroxyanilino]-, 1-(hydrogensulfoxylate) (ester), monosodium salt (8CI); Sulfoxylic acid,mono[[[5-[(3-amino-4-hydroxyphenyl)diarsenyl]-2-hydroxyphenyl]amino]methyl]ester, monosodium salt (9CI); Neo-I.C.I.; Neoarsphenamine; Neosalvarsan;Novarsenobenzol; Novarsenobillon; Novarsenol; Sodium3,3'-diamino-4,4'-dihydroxyarsenobenzene-N-formaldehydesulfoxylate; Sodium3,3'-diamino-4,4'-dihydroxyarsenobenzene-N-methylene-sulfoxylate; Sodiump,p'-dihydroxy-m,m'-diaminoarsenobenzene-N-monomethanol sulfoxylate |
| CAS: | 457-60-3 |
| EINECS: | 207-273-7 |
| Molecular Formula: | C13H14 As2 N2 O4 S . Na |
| Molecular Weight: | 466.17 |
| InChI: | InChI=1/C13H14As2N2O4S.Na/c16-10-5-8(1-3-12(10)18)14-15-9-2-4-13(19)11(6-9)17-7-22(20)21;/h1-6,17-19H,7,16H2,(H,20,21);/q;+1/p-1 |
| Molecular Structure: |
![(C13H14As2N2O4S.Na) Methanol,[5-[(3-amino-4-hydroxyphenyl)arseno]-2-hydroxyanilino]-, 1-(hydrogensulfoxylate) (ester), m...](https://img1.guidechem.com/chem/e/dict/212/457-60-3.jpg) |
| Properties |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Neosalvarsan (CAS NO.457-60-3) is easily oxidized in the air,and accelerate oxidation when the temperature is high .
|
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List.
|
| Flash Point: | °C |
| Safety Data |
| |
 |