| Identification | |
| Name: | Pyridine,2,3-bis(chloromethyl)- |
| Synonyms: | 2,3-Bis(chloromethyl)pyridine; |
| CAS: | 45754-12-9 |
| Molecular Formula: | C7H7 Cl2 N |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H7Cl2N/c8-4-6-2-1-3-10-7(6)5-9/h1-3H,4-5H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 264.48 oC at 760 mmHg |
| Boiling Point: | 264.48 oC at 760 mmHg |
| Density: | 1.275 g/cm3 |
| Refractive index: | 1.548 |
| Specification: |
The Pyridine,2,3-bis(chloromethyl)-, with the cas registry number 45754-12-9, has the systematic name of 2,3-bis(chloromethyl)pyridine. The characteristics of this kind of chemical are as follows: (1)ACD/LogP: 1.76; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/LogD (pH 7.4): 1; (5)ACD/BCF (pH 5.5): 5; (6)ACD/BCF (pH 7.4): 5; (7)ACD/KOC (pH 5.5): 114; (8)ACD/KOC (pH 7.4): 115; (9)#H bond acceptors: 1; (10)#Freely Rotating Bonds: 2; (11)Polar Surface Area: 12.89; (12)Index of Refraction: 1.548; (13)Molar Refractivity: 43.875 cm3; (14)Molar Volume: 138.047 cm3; (15)Polarizability: 17.394 ×10-24 cm3; (16)Surface Tension: 42.237 dyne/cm; (17)Density: 1.275 g/cm3; (18)Flash Point: 139.294 °C; (19)Enthalpy of Vaporization: 48.21 kJ/mol; (20)Boiling Point: 264.48 °C at 760 mmHg; (21)Vapour Pressure: 0.016 mmHg at 25°C. Additionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 264.48 oC at 760 mmHg |
| Safety Data | |
 |
|
