| Identification | |
| Name: | Boronic acid, B-(3-bromo-4-pyridinyl)- |
| Synonyms: | Boronic acid, (3-bromo-4-pyridinyl)- (9CI);3-bromopyridin-4-ylboronic acid; |
| CAS: | 458532-99-5 |
| Molecular Formula: | C5H5BBrNO2 |
| Molecular Weight: | 201.81 |
| InChI: | InChI=1/C5H5BBrNO2/c7-5-3-8-2-1-4(5)6(9)10/h1-3,9-10H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.785 g/cm3 |
| Refractive index: | 1.602 |
| Specification: |
The CAS register number of 3-Bromopyridine-4-boronic acid is 458532-99-5. It also can be called as Boronic acid, B-(3-bromo-4-pyridinyl)- and the systematic name about this chemical is (3-bromopyridin-4-yl)boronic acid. The molecular formula about this chemical is C5H5BBrNO2 and molecular weight is 201.81. It belongs to the following product categories, such as Organoborons; Pyridine and so on. Physical properties about 3-Bromopyridine-4-boronic acid are: (1)ACD/LogP: 0.73; (2)ACD/LogD (pH 5.5): 1; (3)ACD/LogD (pH 7.4): 1; (4)ACD/BCF (pH 5.5): 4; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 94; (7)ACD/KOC (pH 7.4): 28; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Polar Surface Area: 53.35Å2; (12)Index of Refraction: 1.602; (13)Molar Refractivity: 38.808 cm3; (14)Molar Volume: 113.077 cm3; (15)Polarizability: 15.385x10-24cm3; (16)Surface Tension: 62.799 dyne/cm; (17)Enthalpy of Vaporization: 62.747 kJ/mol; (18)Boiling Point: 350.041 °C at 760 mmHg. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
