| Identification | |
| Name: | Benzenepropanoic acid,4-fluoro- |
| Synonyms: | Hydrocinnamicacid, p-fluoro- (6CI,7CI,8CI);3-(4-Fluorophenyl)propanoic acid;3-(p-Fluorophenyl)propionic acid;4-Fluorobenzenepropanoic acid;4-Fluorobenzylacetic acid;NSC 403021;p-Fluorohydrocinnamic acid; |
| CAS: | 459-31-4 |
| EINECS: | -0 |
| Molecular Formula: | C9H9FO2 |
| Molecular Weight: | 168.16 |
| InChI: | InChI=1/C9H9FO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.222 g/cm3 |
| Appearance: | white to off-white crystalline powder or crystals |
| Specification: | white to off-white crystalline powder or crystals Safety Statements:45-36/37/39-26-37/39 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
