| Identification | |
| Name: | 4-Fluorobenzaldehyde |
| Synonyms: | Fluorobenzaldehyde4; Fluorobenzaldehyde colorless liq; Fluorobenzaldehydecolorlessliq; p-Fluorobenzaldehyde |
| CAS: | 459-57-4 |
| EINECS: | 207-293-6 |
| Molecular Formula: | C7H5FO |
| Molecular Weight: | 124.11 |
| InChI: | InChI=1/C7H5FO/c8-7-3-1-6(5-9)2-4-7/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1989 3/PG 3 |
| Density: | 1.157 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5195-1.5215 |
| Water Solubility: | IMMISCIBLE |
| Solubility: | immiscible |
| Appearance: | Clear very slight yellow liquid. |
| Specification: | Clear colorless to yellow liquid Safety Statements:26-36-37/39-36/37/39-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing |
| Packinggroup: | III |
| HS Code: | 29130000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
