| Identification | |
| Name: | Benzenamine,4-fluoro-N-methyl- |
| Synonyms: | Aniline,p-fluoro-N-methyl- (6CI,7CI,8CI);4-Fluoro-N-methylaniline;4-Fluoro-N-methylbenzenamine;N-(4-Fluorophenyl)-N-methylamine;N-(4-Fluorophenyl)methylamine;N-Methyl-4-fluoroaniline;N-Methyl-p-fluoroaniline;p-Fluoro-N-methylaniline; |
| CAS: | 459-59-6 |
| EINECS: | 207-294-1 |
| Molecular Formula: | C7H8FN |
| Molecular Weight: | 125.14 |
| InChI: | InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 6 |
| Density: | 1.1057 |
| Refractive index: | n20/D 1.5320(lit.) |
| Appearance: | clear yellowish liquid |
| Specification: | clear yellowish liquid Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
