| Identification | |
| Name: | Aceticacid, 2-fluoro-, ethyl ester |
| Synonyms: | Aceticacid, fluoro-, ethyl ester (6CI,7CI,8CI,9CI);Ethylmonofluoroacetate;Fluoroacetic acid ethyl ester;Monofluoroacetic acid ethylester;NSC 133459; |
| CAS: | 459-72-3 |
| EINECS: | 207-297-8 |
| Molecular Formula: | C4H7FO2 |
| Molecular Weight: | 106.1 |
| InChI: | InChI=1/C4H7FO2/c1-2-7-4(6)3-5/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2929 |
| Density: | 1.09 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.3745-1.3765 |
| Water Solubility: | DECOMPOSES |
| Solubility: | DECOMPOSES |
| Appearance: | Liquid. Odor of ethyl acetate. |
| Specification: | clear colorless liquid Safety Statements:13-36/37/39-45-28A-16 13:Keep away from food, drink and animal feeding stuffs 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Flammables area |
| Color: | LIQUID |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
