| Identification | |
| Name: | Ethanone,1-(1-aziridinyl)- |
| Synonyms: | Aziridine,1-acetyl- (6CI,7CI,8CI,9CI); 1-Acetylaziridine; 1-Acetylethylenimine;Acetylethylenimide; Acetylethylenimine; N-Acetylaziridine; N-Acetylethylenimine |
| CAS: | 460-07-1 |
| EINECS: | 207-301-8 |
| Molecular Formula: | C4H7 N O |
| Molecular Weight: | 85.12 |
| InChI: | InChI=1/C4H7NO/c1-4(6)5-2-3-5/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 76.2°C |
| Boiling Point: | 174.2°Cat760mmHg |
| Density: | 1.126g/cm3 |
| Stability: | Store in Freezer |
| Refractive index: | 1.494 |
| Specification: |
N-Acetylethyleneimine (CAS NO.460-07-1) is a clear colourless liquid. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Flash Point: | 76.2°C |
| Storage Temperature: | -20?C Freezer |
| Usage: |
N-Acetylethyleneimine (CAS NO.460-07-1) is suitable for the inactivation of foot-and-mouth disease virus (FMDV) and poliovirus for the preparation of virus vaccines. It inactivation of FMDV and poliovirus is demonstrated without impairing the biological properties of several protei. |
| Safety Data | |
 |
|
