| Identification |
| Name: | Cyclopropanecarboxylicacid, ethyl ester |
| Synonyms: | Ethyl cyclopropylcarboxylate;NSC 60696; |
| CAS: | 4606-07-9 |
| EINECS: | 225-010-4 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1/C6H10O2/c1-2-8-6(7)5-3-4-5/h5H,2-4H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3272 |
| Density: | 0.96 |
| Refractive index: | 1.419-1.421 |
| Water Solubility: | immiscible |
| Solubility: | Immiscible with water |
| Appearance: | colorless to slight yellow liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
F:Flammable
|
| |
 |
