| Identification | |
| Name: | 2,4-Imidazolidinedione |
| Synonyms: | 2-Imidazolin-4(or5)-one, 2-hydroxy- (7CI);Hydantoin (6CI,8CI);Glycolylurea;Imidazole-2,4(3H,5H)-dione;NSC 9226; |
| CAS: | 461-72-3 |
| EINECS: | 207-313-3 |
| Molecular Formula: | C3H4N2O2 |
| Molecular Weight: | 100.08 |
| InChI: | InChI=1/C3H4N2O2/c6-2-1-4-3(7)5-2/h1H2,(H2,4,5,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.356g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.702 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | slightly soluble |
| Appearance: | white crystalline powder |
| Specification: | White Solid usageEng:Reactant for synthesis of: N-benzyl aplysinopsin analogs as anticancer agents1 D-glutamic acid based inhibitors2 Antidiabetic chromonyl-2,4-thiazolidinediones3 GSK-3β inhibitors with brain permeability4 Thiazolidinedione derivatives as 15-PGDH inhibitors5 Radio-sensitizing agents6 Safety Statements:24/25-36/37/39-27-26 24/25:Avoid contact with skin and eyes 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29332100 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Anticonvulsive, preserative. |
| Safety Data | |
| Hazard Symbols | |
 |
|
