| Identification | |
| Name: | 6-Azauracil |
| Synonyms: | as-Triazine-3,5(2H,4H)-dione(8CI);as-Triazine-3,5-diol (6CI,7CI);2,3,4,5-Tetrahydro-1,2,4-triazine-3,5-dione; |
| CAS: | 461-89-2 |
| EINECS: | 207-318-0 |
| Molecular Formula: | C3H3N3O2 |
| Molecular Weight: | 113.07 |
| InChI: | InChI=1/C3H3N3O2/c7-2-1-4-6-3(8)5-2/h1H,(H2,5,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 258.3 ºC |
| Boiling Point: | 503.4 ºC at 760 mmHg |
| Density: | 1.86 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.463 |
| Solubility: | Very soluble |
| Appearance: | White solid. |
| Specification: |
6-Azauracil (CAS NO.461-89-2) is also named as 1,2,4-Triazine-3,5(2H,4H)-dione ; 4(6)-Azauracil ; AI3-26412 ; AZU ; Azauracil ; CCRIS 2710 ; IPO 3834 ; NSC 3425 ; USAF CB-30 ; as-Triazine-3,5(2H,4H)-dione ; as-Triazine-3,5-diol . 6-Azauracil (CAS NO.461-89-2) is white to light yellow fine crystalline powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29336980 |
| Flash Point: | 258.3 ºC |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
