| Identification | |
| Name: | Octanoic acid,6,8-dimercapto- |
| CAS: | 462-20-4 |
| Molecular Formula: | C8H16 O2 S2 |
| Molecular Weight: | 208.3414 |
| InChI: | InChI=1/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 60ºC |
| Density: | 1.134 g/cm3 |
| Refractive index: | 1.526 |
| Water Solubility: | Soluble in ethanol |
| Solubility: | Soluble in ethanol |
| Appearance: | light yellow liquid |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Color: | light yellow |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
