| Identification | |
| Name: | alpha-Linolenic acid |
| Synonyms: | a-linolenic acid; 9,12,15-all-cis-Octadecatrienoic acid; (Z,Z,Z)-9,12,15-Octadecatrienoic acid; Linolenic acid; all cis-Delta-9,12,15-octadecatrienoate |
| CAS: | 463-40-1 |
| EINECS: | 207-334-8 |
| Molecular Formula: | C18H30O2 |
| Molecular Weight: | 278.43 |
| InChI: | InChI=1/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3+,7-6+,10-9+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 275.7°C |
| Density: | 0.914 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.480 |
| Water Solubility: | INSOLUBLE |
| Solubility: | Insoluble (Soluble in almost common organic solvents) |
| Appearance: | clear to yellowish liquid |
| Specification: | clear light yellow to yellow liquid usageEng:An essential fatty acid. Occurs as the glyceride in most drying oils. Nutrient. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 275.7°C |
| Storage Temperature: | 2-8°C |
| Usage: | Essential fatty acid. |
| Safety Data | |
| Hazard Symbols | |
 |
|
