| Identification | |
| Name: | Furo[3,4-c]pyridine-1,3-dione |
| Synonyms: | 3,4-Pyridinedicarboxylicanhydride (6CI,8CI);3,4-Pyridinedicarboxylic acid anhydride;Cinchomeronicacid anhydride;Cinchomeronic anhydride;NSC 127964; |
| CAS: | 4664-08-8 |
| Molecular Formula: | C7H3NO3 |
| Molecular Weight: | 149.1 |
| InChI: | InChI=1/C7H3NO3/c9-6-4-1-2-8-3-5(4)7(10)11-6/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 75-77 °C(lit.) |
| Flash Point: | 156.2°C |
| Boiling Point: | 334.6°Cat760mmHg |
| Density: | 1.556g/cm3 |
| Refractive index: | 1.622 |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 156.2°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
