| Identification | |
| Name: | 4,6(1H,5H)-Pyrimidinedione,5-(2-cyclohexen-1-yl)dihydro-5-(2-propen-1-yl)-2-thioxo- |
| Synonyms: | 4,6(1H,5H)-Pyrimidinedione,5-(2-cyclohexen-1-yl)dihydro-5-(2-propenyl)-2-thioxo- (9CI);Barbituric acid,5-allyl-5-(2-cyclohexen-1-yl)-2-thio- (6CI,7CI,8CI);5-Allyl-5-(2-cyclohexen-1-yl)-2-thiobarbituric acid;Kemithal;Thialbarbital;Thialbarbitone;Thialpenton |
| CAS: | 467-36-7 |
| EINECS: | 207-390-3 |
| Molecular Formula: | C13H16 N2 O2 S |
| Molecular Weight: | 264.37 |
| InChI: | InChI=1/C13H16N2O2S/c1-2-8-13(9-6-4-3-5-7-9)10(16)14-12(18)15-11(13)17/h2,4,6,9H,1,3,5,7-8H2,(H2,14,15,16,17,18) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.25g/cm3 |
| Refractive index: | 1.606 |
| Specification: |
Thialbarbital ,its cas register number is 467-36-7. It also can be called 4,6(1H,5H)-Pyrimidinedione, 5-(2-cyclohexen-1-yl)dihydro-5-(2-propenyl)-2-thioxo- ; 5-Allyl-5-(2-cyclohexen-1-yl)-2-thiobarbituric acid ; and Barbituric acid, 5-allyl-5-(2-cyclohexen-1-yl)-2-thio- . |
| Safety Data | |
 |
|
