Identification |
Name: | Phosphonic acid,diphenyl ester |
Synonyms: | Phenylphosphonate ((PhO)2HPO) (6CI,7CI);Diphenoxyphosphine oxide;Diphenyl hydrogenphosphite;Diphenyl phosphonate;Doverphos 213;JP 260;NSC43786;Weston DPP; |
CAS: | 4712-55-4 |
EINECS: | 225-202-8 |
Molecular Formula: | C12H11O3P |
Molecular Weight: | 234.19 |
InChI: | InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
Molecular Structure: |
|
Properties |
Transport: | 1760 |
Melting Point: | 12 oC |
Flash Point: | 350 oF |
Boiling Point: | 218-219 oC26 mm Hg(lit.) |
Refractive index: | n20/D 1.558(lit.) |
Appearance: | clear liquid |
Packinggroup: | III |
Flash Point: | 350 oF |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|