| Identification | |
| Name: | Phenoxazin-5-ium,7-amino-3-(diethylamino)-2-methyl-, chloride (1:1) |
| Synonyms: | (7-Amino-2-methyl-3H-phenoxazin-3-ylidene)diethylammoniumchloride (7CI); 3H-Phenoxazin-7-amine, N,N-diethyl-3-imino-8-methyl-,monohydrochloride; 3H-Phenoxazine, 7-(diethylamino)-3-imino-8-methyl-,monohydrochloride (8CI); Brilliant Cresyl Blue (6CI); Phenoxazin-5-ium,7-amino-3-(diethylamino)-2-methyl-, chloride (9CI); Bright Cresol Blue |
| CAS: | 4712-70-3 |
| EINECS: | 225-203-3 |
| Molecular Formula: | C17H20 N3 O . Cl |
| Molecular Weight: | 317.8132 |
| InChI: | InChI=1S/C17H19N3O.ClH/c1-4-20(5-2)15-10-17-14(8-11(15)3)19-13-7-6-12(18)9-16(13)21-17;/h6-10,18H,4-5H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1170 3 |
| Melting Point: | >300ºC |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | appreciable Stability Stable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed, inhaled or absorbed through the skin. Toxicity data (The |
| Solubility: | appreciable
|
| Appearance: | dark green cystalline solid |
| Specification: | dark green cystalline solid Safety Statements:7-16-24/25-36-26 7:Keep container tightly closed 16:Keep away from sources of ignition - No smoking 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Safety Data | |
 |
|
