| Identification | |
| Name: | Hexahydro-1,3,5-tris(hydroxyethyl)-s-triazine |
| Synonyms: | s-Triazine-1,3,5(2H,4H,6H)-triethanol(8CI);1,3,5-Tris(2-hydroxyethyl)-1,3,5-triazacyclohexane;1,3,5-Tris(2-hydroxyethyl)hexahydro-1,3,5-triazine;1,3,5-Tris(2-hydroxyethyl)hexahydro-s-triazine;Actane;Acticide GR;Bactraclean;Busan 1060;Busan 1506;Cobate C;Grotan BK;Kalpur TE;N,N',N''-Tris(2-hydroxyethyl)hexahydro-s-triazine;N,N',N''-Tris(b-hydroxyethyl)hexahydro-s-triazine;NSC 516387;NipacideBK;Protectol HT;Surcide D;Triadine 3; |
| CAS: | 4719-04-4 |
| EINECS: | 225-208-0 |
| Molecular Formula: | C9H21N3O3 |
| Molecular Weight: | 219.28 |
| InChI: | InChI=1/C9H21N3O3/c13-4-1-10-7-11(2-5-14)9-12(8-10)3-6-15/h13-15H,1-9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.186 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.516 (20 C) |
| Solubility: | Soluble (>=1 g/100 mL at 24 oC) in water |
| Appearance: | Viscous yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Microbiocide. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
