| Identification | |
| Name: | 2,3-Pyrazinecarboxylic anhydride |
| Synonyms: | 2,3-Pyrazinedicarboxylicanhydride (6CI,7CI,8CI);2,3-Pyrazinedicarboxylic acid anhydride;Furano[3,4-b]pyrazine-5,7-dione; |
| CAS: | 4744-50-7 |
| EINECS: | 225-260-4 |
| Molecular Formula: | C6H2N2O3 |
| Molecular Weight: | 150.09 |
| InChI: | InChI=1/C6H2N2O3/c9-5-3-4(6(10)11-5)8-2-1-7-3/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 169.9°C |
| Boiling Point: | 357.3°C at 760 mmHg |
| Density: | 1.686g/cm3 |
| Refractive index: | 1.634 |
| Appearance: | white of off-white power |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 169.9°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
