| Identification |
| Name: | Benzaldehyde, 4-ethyl- |
| Synonyms: | Benzaldehyde,p-ethyl- (6CI,7CI,8CI);p-Ethylbenzaldehyde; |
| CAS: | 4748-78-1 |
| EINECS: | 225-268-8 |
| Molecular Formula: | C9H10O |
| Molecular Weight: | 134.18 |
| InChI: | InChI=1/C9H10O/c1-2-8-3-5-9(7-10)6-4-8/h3-7H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.979 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.537-1.541 |
| Water Solubility: | insoluble in water; soluble in organic solvents, oils |
| Solubility: | insoluble in water; soluble in organic solvents, oils |
| Appearance: | colourless to pale yellow liquid with a sweet, bitter-almond odour |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
