| Identification | |
| Name: | 4(1H)-Pyrimidinone,6-chloro- |
| Synonyms: | 4(3H)-Pyrimidinone,6-chloro- (7CI);4-Pyrimidinol, 6-chloro- (6CI,8CI);4-Chloro-6-hydroxypyrimidine;4-Chloropyrimidin-6-one;NSC 618279;6-Chloro-4-hydroxypyrimidine; |
| CAS: | 4765-77-9 |
| Molecular Formula: | C4H3ClN2O |
| Molecular Weight: | 130.53 |
| InChI: | InChI=1/C4H3ClN2O/c5-3-1-4(8)7-2-6-3/h1-2H,(H,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 194-195 ºC |
| Flash Point: | 74.407°C |
| Boiling Point: | 199.42°C at 760 mmHg |
| Density: | 1.553g/cm3 |
| Refractive index: | 1.632 |
| Appearance: | off-white to pale yellowish solid |
| Specification: | Off-White to Pale Yellowish Solid Safety Statements:22-26-36/37/39 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 74.407°C |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
