| Identification | |
| Name: | 1H-Indole-3-carboxaldehyde,7-methyl- |
| Synonyms: | Indole-3-carboxaldehyde,7-methyl- (7CI,8CI);7-Methyl-1H-indole-3-carboxaldehyde;NSC 91539; |
| CAS: | 4771-50-0 |
| EINECS: | -0 |
| Molecular Formula: | C10H9NO |
| Molecular Weight: | 159.18 |
| InChI: | InChI=1/C10H9NO/c1-7-3-2-4-9-8(6-12)5-11-10(7)9/h2-6,11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.226 g/cm3 |
| Refractive index: | 1.698 |
| Water Solubility: | Soluble in warm ethanol (1% w/v) |
| Solubility: | Soluble in warm ethanol (1% w/v) |
| Appearance: | Pale yellow crystalline powder |
| Specification: |
7-Methylindole-3-carboxaldehyde (4771-50-0) also can be called for 3-Formyl-7-methylindole ; 7-methyl-1H-indole-3-carbaldehyde ; 1H-indole-3-carboxaldehyde, 7-methyl- ; 3-Carboxaldehyde, 7-methylindole- , is building blocks.The structure of 7-Methylindole-3-carboxaldehyde (4771-50-0) is: |
| Storage Temperature: | −20°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
