| Identification | |
| Name: | 1,8-Diaminonaphthalene |
| Synonyms: | 1,8-Naphthalenediamine; 1,8-Naphthylene-Diamine; 1,8-diamina-napthalene |
| CAS: | 479-27-6 |
| EINECS: | 207-529-8 |
| Molecular Formula: | C10H10N2 |
| Molecular Weight: | 158.2 |
| InChI: | InChI=1/C10H10N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H,11-12H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.234 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.6829 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | Brown-red solid. |
| Specification: |
1,8-Naphthalenediamine , its cas register number is 479-27-6. It also can be called 1,8-Diaminonaphthalene ; AI3-03804 ; |
| Packinggroup: | I; II; III |
| HS Code: | 29215940 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Antioxidant for lubricating oils. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
