| Identification | |
| Name: | 1-Hexen-3-ol |
| Synonyms: | n-Propyl vinyl carbinol |
| CAS: | 4798-44-1 |
| EINECS: | 225-355-0 |
| Molecular Formula: | C6H12O |
| Molecular Weight: | 100.16 |
| InChI: | InChI=1/C6H12O/c1-3-5-6(7)4-2/h4,6-7H,2-3,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 |
| Melting Point: | -15 C |
| Density: | 0.835 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.427-1.43 |
| Water Solubility: | INSOLUBLE |
| Solubility: | Insoluble |
| Appearance: | amber liquid |
| Specification: |
1-Hexen-3-ol with cas registry number of 4798-44-1 is also called 1-Vinylbutan-1-ol ; 1-Vinylbutanol ; 3-Hydroxy-1-hexene ; AI3-28612 ; FEMA No. 3608 ; NSC 89701 ; Propyl vinyl carbinol ; Propylvinylcarbinol ; Vinyl propyl carbinol . |
| Packinggroup: | III |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Flammables-area. |
| Safety Data | |
| Hazard Symbols | |
 |
|
