| Identification | |
| Name: | 4H-1-Benzopyran-4-one,2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy- |
| Synonyms: | Flavone,2',3,4',5,7-pentahydroxy- (8CI);2',3,4',5,7-Pentahydroxyflavone;2',4',3,5,7-Pentahydroxyflavone;2'-Hydroxypelargidenolon 1522;3,5,7,2',4'-Pentahydroxyflavone;3,5,7,2',4'-Pentahydroxyflavonol;C.I. 75660;C.I. Natural Yellow 11;LY 002079;NSC 19801; |
| CAS: | 480-16-0 |
| EINECS: | 207-542-9 |
| Molecular Formula: | C15H10O7 |
| Molecular Weight: | 302.2357 |
| InChI: | InChI=1S/C15H10O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,16-19,21H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.799g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.823 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed, inhaled or absorbed through the skin. Toxicity data (The meaning o |
| Solubility: |
|
| Appearance: | yellow to brown powder |
| Specification: |
Morin (CAS NO.480-16-0), its Synonyms are 2',3,4',5,7-Pentahydroxyflavone ; 2',4',3,5,7-Pentahydroxyflavone ; 2',4',5,7-Tetrahydroxyflavan-3-ol ; 2'-Hydroxypelargidenolon 1522 ; 3,5,7,2',4'-Pentahydroxyflavone ; 3,5,7,2',4'-Pentahydroxyflavonol ; 4H-1-Benzopyran-4-one, 2-2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy- ; Al-Morin ; Aurantica . It is yellow to brown powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | yellow |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
