| Identification | |
| Name: | 1,4-Naphthalenedione,5-hydroxy-2-methyl- |
| Synonyms: | 1,4-Naphthoquinone,5-hydroxy-2-methyl- (7CI,8CI);Plumbagin (6CI);2-Methyl-5-hydroxy-1,4-naphthalenedione;2-Methyl-5-hydroxy-1,4-naphthoquinone;2-Methyljuglone;5-Hydroxy-2-methyl-1,4-naphthoquinone;NSC 236613;NSC 688284;Plumbagine;Plumbagone; |
| CAS: | 481-42-5 |
| EINECS: | 207-569-6 |
| Molecular Formula: | C11H8O3 |
| Molecular Weight: | 188.19 |
| InChI: | InChI=1/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2923 8/PG 2 |
| Melting Point: | 76-78 °C(lit.) |
| Flash Point: | 200.2°C |
| Boiling Point: | 383.9°C at 760 mmHg |
| Density: | 1.354g/cm3 |
| Refractive index: | 1.63 |
| Appearance: | orange crystalline powder or crystals |
| Specification: | ORANGE CRYSTALLINE POWDER OR CRYSTALS Safety Statements:22-26-36/37/39-45 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | 200.2°C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
