| Identification | |
| Name: | Phenol,2-(1-methylethoxy)- |
| Synonyms: | Phenol,o-isopropoxy- (7CI,8CI);1-Hydroxy-2-isopropoxybenzene;2-IPP;2-Isopropoxyphenol;2-Isopropyloxyphenol;Catechol monoisopropyl ether;o-Isopropoxyphenol;ortho-Isopropoxyphenol; |
| CAS: | 4812-20-8 |
| EINECS: | 225-379-1 |
| Molecular Formula: | C9H12O2 |
| Molecular Weight: | 152.19 |
| InChI: | InChI=1/C9H12O2/c1-7(2)11-9-6-4-3-5-8(9)10/h3-7,10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 206 - 207 |
| Density: | 1.03 |
| Stability: | No data. |
| Refractive index: | 1.514-1.516 |
| Appearance: | colorless to pink liquid |
| Specification: | clear light yellow to light red-brown liquid Safety Statements:26-36/37/39-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| HS Code: | 29095090 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
