| Identification | |
| Name: | 1H-Pyrrole-2,5-dione,1-hydroxy- |
| Synonyms: | Maleimide,N-hydroxy- (7CI,8CI); N-Hydroxymaleimide |
| CAS: | 4814-74-8 |
| EINECS: | 225-385-4 |
| Molecular Formula: | C4H3 N O3 |
| Molecular Weight: | 113.07 |
| InChI: | InChI=1/C4H3NO3/c6-3-1-2-4(7)5(3)8/h1-2,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Melting Point: | 129-134 oC |
| Density: | 1.793 g/cm3 |
| Stability: | Stable at normal temperatures in tightly closed containers under an inert atmosphere. |
| Refractive index: | 1.666 |
| Solubility: | Very soluble |
| Appearance: | Slight yellow powder |
| Specification: |
1H-Pyrrole-2,5-dione,1-hydroxy- (CAS NO.4814-74-8), its Synonyms are 1-Hydroxy-1H-pyrrole-2,5-dione ; N-Hydroxymaleimide ; 1-Hydroxy-2,5-dihydro-1H-pyrrole-2,5-dione . It is yellow to brown crystalline powder. |
| Packinggroup: | III |
| Storage Temperature: | Keep container closed when not in use. Keep under a nitrogen blanket. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Do not expose to air. Store protected from moisture. |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
