| Identification | |
| Name: | Cyclopentanone,2-pentyl- |
| Synonyms: | 2-Pentyl-1-cyclopentanone;2-Pentylcyclopentanone;2-Pentylcyclopenten-1-one;2-n-Amylcyclopentanone;2-n-Pentyl cyclopentanone;Delphone; |
| CAS: | 4819-67-4 |
| EINECS: | 225-392-2 |
| Molecular Formula: | C10H18O |
| Molecular Weight: | 154.24932 |
| InChI: | InChI=1S/C10H18O/c1-2-3-4-6-9-7-5-8-10(9)11/h9H,2-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 228.16 ºC |
| Density: | 0.895 g/cm3 |
| Refractive index: | 1.451 |
| Water Solubility: | Water Solubility at 25 deg C (mg/L): 192.7 |
| Solubility: | Water Solubility at 25 deg C (mg/L): 192.7 |
| Appearance: | Colorless Liquid |
| Specification: |
The 2-Pentylcyclopentanone with the cas number 4819-67-4 is also called 2-Pentyl-1-cyclopentanone. The IUPAC name is 2-pentylcyclopentan-1-one. Its EINECS registry number is 225-392-2. The molecular formula is C10H18O. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 2.82; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.82; (4)ACD/LogD (pH 7.4): 2.82; (5)ACD/BCF (pH 5.5): 81.22; (6)ACD/BCF (pH 7.4): 81.22; (7)ACD/KOC (pH 5.5): 810.12; (8)ACD/KOC (pH 7.4): 810.12; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 17.07 Å2; (13)Index of Refraction: 1.451; (14)Molar Refractivity: 46.41 cm3; (15)Molar Volume: 172.3 cm3; (16)Polarizability: 18.4×10-24cm3; (17)Surface Tension: 30.2 dyne/cm; (18)Enthalpy of Vaporization: 45.41 kJ/mol; (19)Vapour Pressure: 0.131 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
