| Identification | |
| Name: | Phthalazine,1,4-dihydrazinyl- |
| Synonyms: | 1,4-Phthalazinedione,2,3-dihydro-, dihydrazone (9CI); Phthalazine, 1,4-dihydrazino- (7CI,8CI);1,4-Dihydrazinophthalazine; C 7441; Cassella 532; Dihydralazin; Dihydralazine;Dihydrazinophthalazine; Hypopresol; NSC 526654; Nepresol; Nepresolin;Nepressol; Ophthazin; Tonolysin |
| CAS: | 484-23-1 |
| EINECS: | 207-605-0 |
| Molecular Formula: | C8H10 N6 |
| Molecular Weight: | 190.21 |
| InChI: | InChI=1/C8H10N6/c9-11-7-5-3-1-2-4-6(5)8(12-10)14-13-7/h1-4H,9-10H2,(H,11,13)(H,12,14) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 180ºC |
| Density: | 1.543 g/cm3 |
| Refractive index: | 1.899 |
| Specification: | usageEng:An antihypertensive agent of the hydrazine class used during pregnancies in dialysis patients with familial mediterranean fever and cystinosis under hemodialysis. |
| Usage: | An antihypertensive agent of the hydrazine class used during pregnancies in dialysis patients with familial mediterranean fever and cystinosis under hemodialysis. |
| Safety Data | |
 |
|
