| Identification | |
| Name: | N-Formyl-N-methyl-p-(phenylazo)aniline |
| Synonyms: | N-Methyl-N-[4-(phenylazo)phenyl]formamide |
| CAS: | 4845-14-1 |
| Molecular Formula: | C14H13N3O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H13N3O/c1-17(11-18)14-9-7-13(8-10-14)16-15-12-5-3-2-4-6-12/h2-11H,1H3/b16-15+ |
| Molecular Structure: | ![(C14H13N3O) N-Methyl-N-[4-(phenylazo)phenyl]formamide](https://img.guidechem.com/crawlimg/4845-14-1.png) |
| Properties | |
| Flash Point: | 215°C |
| Boiling Point: | 431.9°C at 760 mmHg |
| Density: | 1.09g/cm3 |
| Refractive index: | 1.582 |
| Specification: |
N-Formyl-N-methyl-p-(phenylazo)aniline , its cas register number is 4845-14-1. It also can be called Aniline, N-formyl-N-methyl-p-(phenylazo)- ; and 4-Formylmonomethylaminoazobenzene . |
| Flash Point: | 215°C |
| Safety Data | |
 |
|
