| Identification | |
| Name: | 2-Butenoic acid,3-methyl-, 2-(1-methylpropyl)-4,6-dinitrophenyl ester |
| Synonyms: | Crotonicacid, 3-methyl-, 2-sec-butyl-4,6-dinitrophenyl ester (7CI,8CI); 2-(1-Methylpropyl)-4,6-dinitrophenylb,b-dimethacrylate; 2-sec-Butyl-4,6-dinitrophenyl3-methyl-2-butenoate; 2-sec-Butyl-4,6-dinitrophenyl 3-methylcrotonate; Acricid;Binapacryl; Dinapacryl; Endosan; HOE 2784; Morocide; NIA 9044; Niagara 9044 |
| CAS: | 485-31-4 |
| EINECS: | 207-612-9 |
| Molecular Formula: | C15H18 N2 O6 |
| Molecular Weight: | 322.35 |
| InChI: | InChI=1/C15H18N2O6/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3/h6-8,10H,5H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2779 |
| Flash Point: | 171.7°C |
| Boiling Point: | 436.7°Cat760mmHg |
| Density: | 1.238g/cm3 |
| Refractive index: | 1.553 |
| Solubility: | Insoluble in water but soluble in organic solvents as follows: acetone 78%; ethanol 11%; isophorone 57%; kerosene 10%; xylene 70% Sol in: 400 mg/l hexane; greater than 500 g/l dichloromethane, ethyl acetate, toluene; 21 g/l methanol Sol in 75% methylene chloride |
| Specification: |
Removal in wastewater treatment of Binapacryl (CAS No.485-31-4) can be stated as follows: |
| Packinggroup: | III |
| Flash Point: | 171.7°C |
| Storage Temperature: | 0-6°C |
| Color: | COLORLESS CRYSTALLINE POWDER Pale yellow to brownish crystals |
| Safety Data | |
| Hazard Symbols |
T: Toxic
N: Dangerous for the environment
|
 |
|
