| Identification |
| Name: | Cinchonidine |
| Synonyms: | alpha-Quinidine; (8alpha,9R)-Cinchonan-9-ol; 98% |
| CAS: | 485-71-2 |
| EINECS: | 207-622-3 |
| Molecular Formula: | C19H22N2O |
| Molecular Weight: | 294.39 |
| InChI: | InChI=1/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1544 |
| Density: | 1.2 g/cm3 |
| Stability: | Stable, but light-sensitive. Incompatible with strong oxidizing agents. |
| Refractive index: | -107.5 ° (C=1, EtOH) |
| Alpha: | -115 º (C=1, ETOH) |
| Water Solubility: | Insoluble |
| Solubility: | insoluble in water |
| Appearance: | White powder |
| Specification: | white to light yellow crystal powde Safety Statements:22-24/25-36/37-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36/37:Wear suitable protective clothing and gloves 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
| Packinggroup: | III |
| HS Code: | 29392900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Sensitive: | Light Sensitive |
| Usage: | Antimalarial agent. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |