| Identification |
| Name: | Isoquinoline-1-carboxylic acid |
| Synonyms: | 1-Isoquinolinecarboxylic acid;isoquinoline-1-carboxylate;Isoquinaldic acid; |
| CAS: | 486-73-7 |
| EINECS: | 207-639-6 |
| Molecular Formula: | C10H7NO2 |
| Molecular Weight: | 173.17 |
| InChI: | InChI=1/C10H7NO2/c12-10(13)9-8-4-2-1-3-7(8)5-6-11-9/h1-6H,(H,12,13) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2416 3/PG 2 |
| Density: | 1.339 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.358(lit.) |
| Solubility: | Very soluble |
| Appearance: | yellow to brown powder |
| Specification: | cream to yellow-brown powder Safety Statements:22-24/25-45-36/37/39-27-16-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 27:Take off immediately all contaminated clothing 16:Keep away from sources of ignition - No smoking 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
| HS Code: | 29334990 |
| Storage Temperature: | 0-6°C |
| Safety Data |
| Hazard Symbols |
|
| |
 |