| Identification | |
| Name: | Benzoic acid,3-mercapto- |
| Synonyms: | Benzoicacid, m-mercapto- (7CI,8CI);NSC 32021;m-Mercaptobenzoic acid; |
| CAS: | 4869-59-4 |
| Molecular Formula: | C7H6O2S |
| Molecular Weight: | 154.19 |
| InChI: | InChI=1/C7H6O2S/c8-7(9)5-2-1-3-6(10)4-5/h1-4,10H,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 149°C |
| Boiling Point: | 322.7°C at 760 mmHg |
| Density: | 1.345 g/cm3 |
| Stability: | Sensitive to Oxidation in Air |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powder usageEng:An aromatic thiol compound reducing agent hair cosmetic Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Flash Point: | 149°C |
| Usage: | An aromatic thiol compound reducing agent hair cosmetic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
