| Identification | |
| Name: | Glycine,N-(2-hydroxybenzoyl)- |
| Synonyms: | Hippuricacid, o-hydroxy- (8CI);Salicyluric acid (6CI);(2-Hydroxybenzoyl)glycine;2-Hydroxyhippuric acid;N-(o-Hydroxybenzoyl)glycine;N-Salicyloylglycine;NSC524135;Salicyloylglycine;o-Hydroxyhippuric acid; |
| CAS: | 487-54-7 |
| EINECS: | 207-661-6 |
| Molecular Formula: | C9H9NO4 |
| Molecular Weight: | 195.19 |
| InChI: | InChI=1S/C9H9NO4/c11-7-4-2-1-3-6(7)9(14)10-5-8(12)13/h1-4,11H,5H2,(H,10,14)(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.4 g/cm3 |
| Solubility: | soluble in water |
| Appearance: | light gray crystalline powder |
| Specification: | Light gray crystalline powder usageEng:Metabolite of Salicylic Acid (S088125). Safety Statements:24/25-36/37/39-27-26 24/25:Avoid contact with skin and eyes 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Usage: | Metabolite of Salicylic Acid (S088125). |
| Safety Data | |
 |
|
