| Identification | |
| Name: | Jasmone |
| Synonyms: | 2-Cyclopenten-1-one,3-methyl-2-(2-pentenyl)-, (Z)- (8CI);2-Cyclopenten-1-one,3-methyl-2-(2Z)-2-pentenyl- (9CI);Jasmone (6CI);(Z)-Jasmone;3-Methyl-2-(2-cis-pentenyl)-2-cyclopenten-1-one;3-Methyl-2-(cis-2-pentenyl)-2-cyclopenten-1-one;cis-Jasmone; |
| CAS: | 488-10-8 |
| EINECS: | 207-668-4 |
| Molecular Formula: | C11H16O |
| Molecular Weight: | 164.25 |
| InChI: | InChI=1/C11H16O/c1-3-4-5-6-10-9(2)7-8-11(10)12/h4-5H,3,6-8H2,1-2H3/b5-4- |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 203 - 205 |
| Flash Point: | 225? |
| Density: | 0.94 |
| Stability: | No data. |
| Refractive index: | 1.498 |
| Solubility: | Insoluble |
| Appearance: | Pale yellow oily liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II; III |
| Flash Point: | 225? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Substance is used in as an aroma for perfumes. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
