| Identification | |
| Name: | Mucobromic acid |
| Synonyms: | Mucobromic acid, 98+%; 2,3-Dibromo-4-oxo-2-butenoic Acid; 2,3-Dibromomalealdehydic acid |
| CAS: | 488-11-9 |
| EINECS: | 207-670-5 |
| Molecular Formula: | C4H2Br2O3 |
| Molecular Weight: | 257.87 |
| InChI: | InChI=1/C4H2Br2O3/c5-2(1-7)3(6)4(8)9/h1H,(H,8,9)/b3-2- |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8 |
| Density: | 2.43 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | methanol: 0.1 g/mL, clear |
| Solubility: | methanol: 0.1 g/mL, clear |
| Appearance: | White crystal |
| Specification: | White to beige crystalline powder Safety Statements:26-36/37/39-45-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 27:Take off immediately all contaminated clothing |
| Packinggroup: | III |
| HS Code: | 29183000 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
