| Identification | |
| Name: | Cyclohexanone,4-phenyl- |
| Synonyms: | 4-Phenyl-1-cyclohexanone;NSC 28473; |
| CAS: | 4894-75-1 |
| EINECS: | 225-517-0 |
| Molecular Formula: | C12H14O |
| Molecular Weight: | 174.24 |
| InChI: | InChI=1/C12H14O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.042 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.537 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | white to off-white crystalline powder |
| Specification: |
Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed.Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Use with adequate ventilation. Minimize dust generation and accumulation. Avoid contact with eyes, skin, and clothing. Keep container tightly closed. Avoid ingestion and inhalation. |
| HS Code: | 29143900 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Safety Data | |
 |
|
